About 3-(3-chloro-5,6-dihydroxy-7-nitro-1-benzothiophen-2-yl)morpholine-4-carbaldehyde
3-(3-chloro-5,6-dihydroxy-7-nitro-1-benzothiophen-2-yl)morpholine-4-carbaldehyde (PubChem CID 91110981) has the molecular formula C13H11ClN2O6S
and a molecular weight of 358.76 g/mol. Its IUPAC name is 3-(3-chloro-5,6-dihydroxy-7-nitro-1-benzothiophen-2-yl)morpholine-4-carbaldehyde.
Molecular Properties
| Compound Name | 3-(3-chloro-5,6-dihydroxy-7-nitro-1-benzothiophen-2-yl)morpholine-4-carbaldehyde |
| PubChem CID | 91110981 |
| Molecular Formula | C13H11ClN2O6S |
| Molecular Weight | 358.76 g/mol |
| Exact Mass | 358.00 |
| IUPAC Name | 3-(3-chloro-5,6-dihydroxy-7-nitro-1-benzothiophen-2-yl)morpholine-4-carbaldehyde |
| SMILES | O=CN1CCOCC1c1sc2c([N+](=O)[O-])c(O)c(O)cc2c1Cl |
| InChI | InChI=1S/C13H11ClN2O6S/c14-9-6-3-8(18)11(19)10(16(20)21)12(6)23-13(9)7-4-22-2-1-15(7)5-17/h3,5,7,18-19H,1-2,4H2 |
| InChIKey | CAYMCTLTMMRGGF-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 113.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.76 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 3-(3-chloro-5,6-dihydroxy-7-nitro-1-benzothiophen-2-yl)morpholine-4-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-chloro-5,6-dihydroxy-7-nitro-1-benzothiophen-2-yl)morpholine-4-carbaldehyde?
The IUPAC name of 3-(3-chloro-5,6-dihydroxy-7-nitro-1-benzothiophen-2-yl)morpholine-4-carbaldehyde (CID 91110981) is 3-(3-chloro-5,6-dihydroxy-7-nitro-1-benzothiophen-2-yl)morpholine-4-carbaldehyde.
What is the SMILES notation for 3-(3-chloro-5,6-dihydroxy-7-nitro-1-benzothiophen-2-yl)morpholine-4-carbaldehyde?
The canonical SMILES for 3-(3-chloro-5,6-dihydroxy-7-nitro-1-benzothiophen-2-yl)morpholine-4-carbaldehyde is O=CN1CCOCC1c1sc2c([N+](=O)[O-])c(O)c(O)cc2c1Cl.
What is the InChIKey of 3-(3-chloro-5,6-dihydroxy-7-nitro-1-benzothiophen-2-yl)morpholine-4-carbaldehyde?
The InChIKey is CAYMCTLTMMRGGF-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H11ClN2O6S/c14-9-6-3-8(18)11(19)10(16(20)21)12(6)23-13(9)7-4-22-2-1-15(7)5-17/h3,5,7,18-19H,1-2,4H2.
What are the key properties of 3-(3-chloro-5,6-dihydroxy-7-nitro-1-benzothiophen-2-yl)morpholine-4-carbaldehyde?
3-(3-chloro-5,6-dihydroxy-7-nitro-1-benzothiophen-2-yl)morpholine-4-carbaldehyde has a molecular weight of 358.76 g/mol, XLogP of 2.40, 3 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-chloro-5,6-dihydroxy-7-nitro-1-benzothiophen-2-yl)morpholine-4-carbaldehyde is sourced from PubChem (CID 91110981), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).