C19H25N5O4 — CID 91111076
10-[2-[4,4-dihydroxybutyl(methyl)amino]ethyl]-7,8-dimethylbenzo[g]pteridine-2,4-dione (PubChem CID 91111076) has the molecular formula C19H25N5O4 and a molecular weight of 387.44 g/mol. Its IUPAC name is 10-[2-[4,4-dihydroxybutyl(methyl)amino]ethyl]-7,8-dimethylbenzo[g]pteridine-2,4-dione.
| Compound Name | 10-[2-[4,4-dihydroxybutyl(methyl)amino]ethyl]-7,8-dimethylbenzo[g]pteridine-2,4-dione |
|---|---|
| PubChem CID | 91111076 |
| Molecular Formula | C19H25N5O4 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.19 |
| IUPAC Name | 10-[2-[4,4-dihydroxybutyl(methyl)amino]ethyl]-7,8-dimethylbenzo[g]pteridine-2,4-dione |
| SMILES | Cc1cc2nc3c(=O)[nH]c(=O)nc-3n(CCN(C)CCCC(O)O)c2cc1C |
| InChI | InChI=1S/C19H25N5O4/c1-11-9-13-14(10-12(11)2)24(8-7-23(3)6-4-5-15(25)26)17-16(20-13)18(27)22-19(28)21-17/h9-10,15,25-26H,4-8H2,1-3H3,(H,22,27,28) |
| InChIKey | HCJCYRHEJQLYQS-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 124.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|