C6H11Cl3O2Si — CID 91111882
2-methoxyethoxy-methyl-(2,2,2-trichloroethylidene)silane (PubChem CID 91111882) has the molecular formula C6H11Cl3O2Si and a molecular weight of 249.60 g/mol. Its IUPAC name is 2-methoxyethoxy-methyl-(2,2,2-trichloroethylidene)silane.
| Compound Name | 2-methoxyethoxy-methyl-(2,2,2-trichloroethylidene)silane |
|---|---|
| PubChem CID | 91111882 |
| Molecular Formula | C6H11Cl3O2Si |
| Molecular Weight | 249.60 g/mol |
| Exact Mass | 247.96 |
| IUPAC Name | 2-methoxyethoxy-methyl-(2,2,2-trichloroethylidene)silane |
| SMILES | COCCO[Si](C)=CC(Cl)(Cl)Cl |
| InChI | InChI=1S/C6H11Cl3O2Si/c1-10-3-4-11-12(2)5-6(7,8)9/h5H,3-4H2,1-2H3 |
| InChIKey | QWSMJFHSGIFCFG-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.60 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|