C11H14F6O — CID 91112145
5-(1,1-difluoropropoxy)-5,6,6-trifluorobicyclo[2.2.1]hept-2-ene;fluoromethane (PubChem CID 91112145) has the molecular formula C11H14F6O and a molecular weight of 276.22 g/mol. Its IUPAC name is 5-(1,1-difluoropropoxy)-5,6,6-trifluorobicyclo[2.2.1]hept-2-ene;fluoromethane.
| Compound Name | 5-(1,1-difluoropropoxy)-5,6,6-trifluorobicyclo[2.2.1]hept-2-ene;fluoromethane |
|---|---|
| PubChem CID | 91112145 |
| Molecular Formula | C11H14F6O |
| Molecular Weight | 276.22 g/mol |
| Exact Mass | 276.09 |
| IUPAC Name | 5-(1,1-difluoropropoxy)-5,6,6-trifluorobicyclo[2.2.1]hept-2-ene;fluoromethane |
| SMILES | CCC(F)(F)OC1(F)C2C=CC(C2)C1(F)F.CF |
| InChI | InChI=1S/C10H11F5O.CH3F/c1-2-8(11,12)16-10(15)7-4-3-6(5-7)9(10,13)14;1-2/h3-4,6-7H,2,5H2,1H3;1H3 |
| InChIKey | MOEIFCCNEZNTRH-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.22 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|