C15H17N3 — CID 91112295
12,14-dimethyl-3,5-diazatricyclo[9.4.0.02,7]pentadeca-1(15),2,4,6,11,13-hexaen-4-amine (PubChem CID 91112295) has the molecular formula C15H17N3 and a molecular weight of 239.32 g/mol. Its IUPAC name is 12,14-dimethyl-3,5-diazatricyclo[9.4.0.02,7]pentadeca-1(15),2,4,6,11,13-hexaen-4-amine.
| Compound Name | 12,14-dimethyl-3,5-diazatricyclo[9.4.0.02,7]pentadeca-1(15),2,4,6,11,13-hexaen-4-amine |
|---|---|
| PubChem CID | 91112295 |
| Molecular Formula | C15H17N3 |
| Molecular Weight | 239.32 g/mol |
| Exact Mass | 239.14 |
| IUPAC Name | 12,14-dimethyl-3,5-diazatricyclo[9.4.0.02,7]pentadeca-1(15),2,4,6,11,13-hexaen-4-amine |
| SMILES | Cc1cc(C)c2c(c1)-c1nc(N)ncc1CCC2 |
| InChI | InChI=1S/C15H17N3/c1-9-6-10(2)12-5-3-4-11-8-17-15(16)18-14(11)13(12)7-9/h6-8H,3-5H2,1-2H3,(H2,16,17,18) |
| InChIKey | DMQQZTFOPZBHJL-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 51.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.32 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |