C8H12O5 — CID 91112319
(3aR,7S,7aR)-7-hydroxy-2,2-dimethyl-3a,6,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-4-one (PubChem CID 91112319) has the molecular formula C8H12O5 and a molecular weight of 188.18 g/mol. Its IUPAC name is (3aR,7S,7aR)-7-hydroxy-2,2-dimethyl-3a,6,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-4-one.
| Compound Name | (3aR,7S,7aR)-7-hydroxy-2,2-dimethyl-3a,6,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-4-one |
|---|---|
| PubChem CID | 91112319 |
| Molecular Formula | C8H12O5 |
| Molecular Weight | 188.18 g/mol |
| Exact Mass | 188.07 |
| IUPAC Name | (3aR,7S,7aR)-7-hydroxy-2,2-dimethyl-3a,6,7,7a-tetrahydro-[1,3]dioxolo[4,5-c]pyran-4-one |
| SMILES | CC1(C)O[C@@H]2[C@@H](O)COC(=O)[C@@H]2O1 |
| InChI | InChI=1S/C8H12O5/c1-8(2)12-5-4(9)3-11-7(10)6(5)13-8/h4-6,9H,3H2,1-2H3/t4-,5+,6+/m0/s1 |
| InChIKey | UWKYRBKUZBVUGN-KVQBGUIXSA-N |
| XLogP | -0.58 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.18 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |