C14H22O3 — CID 91112711
(3S,8S)-3,8-di(propan-2-yl)-3,4,7,8-tetrahydrooxonine-2,9-dione (PubChem CID 91112711) has the molecular formula C14H22O3 and a molecular weight of 238.33 g/mol. Its IUPAC name is (3S,8S)-3,8-di(propan-2-yl)-3,4,7,8-tetrahydrooxonine-2,9-dione.
| Compound Name | (3S,8S)-3,8-di(propan-2-yl)-3,4,7,8-tetrahydrooxonine-2,9-dione |
|---|---|
| PubChem CID | 91112711 |
| Molecular Formula | C14H22O3 |
| Molecular Weight | 238.33 g/mol |
| Exact Mass | 238.16 |
| IUPAC Name | (3S,8S)-3,8-di(propan-2-yl)-3,4,7,8-tetrahydrooxonine-2,9-dione |
| SMILES | CC(C)[C@@H]1CC=CC[C@@H](C(C)C)C(=O)OC1=O |
| InChI | InChI=1S/C14H22O3/c1-9(2)11-7-5-6-8-12(10(3)4)14(16)17-13(11)15/h5-6,9-12H,7-8H2,1-4H3/t11-,12-/m0/s1 |
| InChIKey | CAEBIQMUSOOHOI-RYUDHWBXSA-N |
| XLogP | 2.95 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.33 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|