C8H8F8O2 — CID 91112928
1-(3-ethenoxy-1,1,1-trifluoropropan-2-yl)oxy-1,1,3,3,3-pentafluoropropane (PubChem CID 91112928) has the molecular formula C8H8F8O2 and a molecular weight of 288.13 g/mol. Its IUPAC name is 1-(3-ethenoxy-1,1,1-trifluoropropan-2-yl)oxy-1,1,3,3,3-pentafluoropropane.
| Compound Name | 1-(3-ethenoxy-1,1,1-trifluoropropan-2-yl)oxy-1,1,3,3,3-pentafluoropropane |
|---|---|
| PubChem CID | 91112928 |
| Molecular Formula | C8H8F8O2 |
| Molecular Weight | 288.13 g/mol |
| Exact Mass | 288.04 |
| IUPAC Name | 1-(3-ethenoxy-1,1,1-trifluoropropan-2-yl)oxy-1,1,3,3,3-pentafluoropropane |
| SMILES | C=COCC(OC(F)(F)CC(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C8H8F8O2/c1-2-17-3-5(8(14,15)16)18-7(12,13)4-6(9,10)11/h2,5H,1,3-4H2 |
| InChIKey | CZDWHSJQRWBKRP-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.13 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|