C25H23NO3S — CID 91113029
methyl (3S,4S)-1-oxo-2-(2-phenylethyl)-3-(2-sulfanylphenyl)-3,4-dihydroisoquinoline-4-carboxylate (PubChem CID 91113029) has the molecular formula C25H23NO3S and a molecular weight of 417.53 g/mol. Its IUPAC name is methyl (3S,4S)-1-oxo-2-(2-phenylethyl)-3-(2-sulfanylphenyl)-3,4-dihydroisoquinoline-4-carboxylate.
| Compound Name | methyl (3S,4S)-1-oxo-2-(2-phenylethyl)-3-(2-sulfanylphenyl)-3,4-dihydroisoquinoline-4-carboxylate |
|---|---|
| PubChem CID | 91113029 |
| Molecular Formula | C25H23NO3S |
| Molecular Weight | 417.53 g/mol |
| Exact Mass | 417.14 |
| IUPAC Name | methyl (3S,4S)-1-oxo-2-(2-phenylethyl)-3-(2-sulfanylphenyl)-3,4-dihydroisoquinoline-4-carboxylate |
| SMILES | COC(=O)[C@H]1c2ccccc2C(=O)N(CCc2ccccc2)[C@@H]1c1ccccc1S |
| InChI | InChI=1S/C25H23NO3S/c1-29-25(28)22-18-11-5-6-12-19(18)24(27)26(16-15-17-9-3-2-4-10-17)23(22)20-13-7-8-14-21(20)30/h2-14,22-23,30H,15-16H2,1H3/t22-,23+/m0/s1 |
| InChIKey | UBEZBABHNJYRQH-XZOQPEGZSA-N |
| XLogP | 4.67 |
| TPSA | 46.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.53 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|