About [(1S)-5-[3-[(5-cyano-2-pyridinyl)amino]propoxy]-2,3-dihydro-1H-inden-1-yl] butanoate
[(1S)-5-[3-[(5-cyano-2-pyridinyl)amino]propoxy]-2,3-dihydro-1H-inden-1-yl] butanoate (PubChem CID 91113157) has the molecular formula C22H25N3O3
and a molecular weight of 379.46 g/mol. Its IUPAC name is [(1S)-5-[3-[(5-cyano-2-pyridinyl)amino]propoxy]-2,3-dihydro-1H-inden-1-yl] butanoate.
Molecular Properties
| Compound Name | [(1S)-5-[3-[(5-cyano-2-pyridinyl)amino]propoxy]-2,3-dihydro-1H-inden-1-yl] butanoate |
| PubChem CID | 91113157 |
| Molecular Formula | C22H25N3O3 |
| Molecular Weight | 379.46 g/mol |
| Exact Mass | 379.19 |
| IUPAC Name | [(1S)-5-[3-[(5-cyano-2-pyridinyl)amino]propoxy]-2,3-dihydro-1H-inden-1-yl] butanoate |
| SMILES | CCCC(=O)O[C@H]1CCc2cc(OCCCNc3ccc(C#N)cn3)ccc21 |
| InChI | InChI=1S/C22H25N3O3/c1-2-4-22(26)28-20-9-6-17-13-18(7-8-19(17)20)27-12-3-11-24-21-10-5-16(14-23)15-25-21/h5,7-8,10,13,15,20H,2-4,6,9,11-12H2,1H3,(H,24,25)/t20-/m0/s1 |
| InChIKey | JBVXJJVDLAMDFP-FQEVSTJZSA-N |
| XLogP | 4.16 |
| TPSA | 84.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.46 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze [(1S)-5-[3-[(5-cyano-2-pyridinyl)amino]propoxy]-2,3-dihydro-1H-inden-1-yl] butanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S)-5-[3-[(5-cyano-2-pyridinyl)amino]propoxy]-2,3-dihydro-1H-inden-1-yl] butanoate?
The IUPAC name of [(1S)-5-[3-[(5-cyano-2-pyridinyl)amino]propoxy]-2,3-dihydro-1H-inden-1-yl] butanoate (CID 91113157) is [(1S)-5-[3-[(5-cyano-2-pyridinyl)amino]propoxy]-2,3-dihydro-1H-inden-1-yl] butanoate.
What is the SMILES notation for [(1S)-5-[3-[(5-cyano-2-pyridinyl)amino]propoxy]-2,3-dihydro-1H-inden-1-yl] butanoate?
The canonical SMILES for [(1S)-5-[3-[(5-cyano-2-pyridinyl)amino]propoxy]-2,3-dihydro-1H-inden-1-yl] butanoate is CCCC(=O)O[C@H]1CCc2cc(OCCCNc3ccc(C#N)cn3)ccc21.
What is the InChIKey of [(1S)-5-[3-[(5-cyano-2-pyridinyl)amino]propoxy]-2,3-dihydro-1H-inden-1-yl] butanoate?
The InChIKey is JBVXJJVDLAMDFP-FQEVSTJZSA-N. The full InChI is InChI=1S/C22H25N3O3/c1-2-4-22(26)28-20-9-6-17-13-18(7-8-19(17)20)27-12-3-11-24-21-10-5-16(14-23)15-25-21/h5,7-8,10,13,15,20H,2-4,6,9,11-12H2,1H3,(H,24,25)/t20-/m0/s1.
What are the key properties of [(1S)-5-[3-[(5-cyano-2-pyridinyl)amino]propoxy]-2,3-dihydro-1H-inden-1-yl] butanoate?
[(1S)-5-[3-[(5-cyano-2-pyridinyl)amino]propoxy]-2,3-dihydro-1H-inden-1-yl] butanoate has a molecular weight of 379.46 g/mol, XLogP of 4.16, 9 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S)-5-[3-[(5-cyano-2-pyridinyl)amino]propoxy]-2,3-dihydro-1H-inden-1-yl] butanoate is sourced from PubChem (CID 91113157), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).