About 2-[(3,4,5-trimethoxyphenyl)methylimino]cyclohexan-1-one
2-[(3,4,5-trimethoxyphenyl)methylimino]cyclohexan-1-one (PubChem CID 91113402) has the molecular formula C16H21NO4
and a molecular weight of 291.35 g/mol. Its IUPAC name is 2-[(3,4,5-trimethoxyphenyl)methylimino]cyclohexan-1-one.
Molecular Properties
| Compound Name | 2-[(3,4,5-trimethoxyphenyl)methylimino]cyclohexan-1-one |
| PubChem CID | 91113402 |
| Molecular Formula | C16H21NO4 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.15 |
| IUPAC Name | 2-[(3,4,5-trimethoxyphenyl)methylimino]cyclohexan-1-one |
| SMILES | COc1cc(C/N=C2\CCCCC2=O)cc(OC)c1OC |
| InChI | InChI=1S/C16H21NO4/c1-19-14-8-11(9-15(20-2)16(14)21-3)10-17-12-6-4-5-7-13(12)18/h8-9H,4-7,10H2,1-3H3/b17-12+ |
| InChIKey | RFJPVXBJFCWCTH-SFQUDFHCSA-N |
| XLogP | 2.80 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[(3,4,5-trimethoxyphenyl)methylimino]cyclohexan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3,4,5-trimethoxyphenyl)methylimino]cyclohexan-1-one?
The IUPAC name of 2-[(3,4,5-trimethoxyphenyl)methylimino]cyclohexan-1-one (CID 91113402) is 2-[(3,4,5-trimethoxyphenyl)methylimino]cyclohexan-1-one.
What is the SMILES notation for 2-[(3,4,5-trimethoxyphenyl)methylimino]cyclohexan-1-one?
The canonical SMILES for 2-[(3,4,5-trimethoxyphenyl)methylimino]cyclohexan-1-one is COc1cc(C/N=C2\CCCCC2=O)cc(OC)c1OC.
What is the InChIKey of 2-[(3,4,5-trimethoxyphenyl)methylimino]cyclohexan-1-one?
The InChIKey is RFJPVXBJFCWCTH-SFQUDFHCSA-N. The full InChI is InChI=1S/C16H21NO4/c1-19-14-8-11(9-15(20-2)16(14)21-3)10-17-12-6-4-5-7-13(12)18/h8-9H,4-7,10H2,1-3H3/b17-12+.
What are the key properties of 2-[(3,4,5-trimethoxyphenyl)methylimino]cyclohexan-1-one?
2-[(3,4,5-trimethoxyphenyl)methylimino]cyclohexan-1-one has a molecular weight of 291.35 g/mol, XLogP of 2.80, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3,4,5-trimethoxyphenyl)methylimino]cyclohexan-1-one is sourced from PubChem (CID 91113402), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).