About ethane;2-(2'-oxospiro[2H-1-benzofuran-3,3'-indole]-1'-yl)acetamide
ethane;2-(2'-oxospiro[2H-1-benzofuran-3,3'-indole]-1'-yl)acetamide (PubChem CID 91113408) has the molecular formula C19H20N2O3
and a molecular weight of 324.38 g/mol. Its IUPAC name is ethane;2-(2'-oxospiro[2H-1-benzofuran-3,3'-indole]-1'-yl)acetamide.
Molecular Properties
| Compound Name | ethane;2-(2'-oxospiro[2H-1-benzofuran-3,3'-indole]-1'-yl)acetamide |
| PubChem CID | 91113408 |
| Molecular Formula | C19H20N2O3 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.15 |
| IUPAC Name | ethane;2-(2'-oxospiro[2H-1-benzofuran-3,3'-indole]-1'-yl)acetamide |
| SMILES | CC.NC(=O)CN1C(=O)C2(COc3ccccc32)c2ccccc21 |
| InChI | InChI=1S/C17H14N2O3.C2H6/c18-15(20)9-19-13-7-3-1-5-11(13)17(16(19)21)10-22-14-8-4-2-6-12(14)17;1-2/h1-8H,9-10H2,(H2,18,20);1-2H3 |
| InChIKey | ZLVKKPGRWYMDSZ-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethane;2-(2'-oxospiro[2H-1-benzofuran-3,3'-indole]-1'-yl)acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-(2'-oxospiro[2H-1-benzofuran-3,3'-indole]-1'-yl)acetamide?
The IUPAC name of ethane;2-(2'-oxospiro[2H-1-benzofuran-3,3'-indole]-1'-yl)acetamide (CID 91113408) is ethane;2-(2'-oxospiro[2H-1-benzofuran-3,3'-indole]-1'-yl)acetamide.
What is the SMILES notation for ethane;2-(2'-oxospiro[2H-1-benzofuran-3,3'-indole]-1'-yl)acetamide?
The canonical SMILES for ethane;2-(2'-oxospiro[2H-1-benzofuran-3,3'-indole]-1'-yl)acetamide is CC.NC(=O)CN1C(=O)C2(COc3ccccc32)c2ccccc21.
What is the InChIKey of ethane;2-(2'-oxospiro[2H-1-benzofuran-3,3'-indole]-1'-yl)acetamide?
The InChIKey is ZLVKKPGRWYMDSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H14N2O3.C2H6/c18-15(20)9-19-13-7-3-1-5-11(13)17(16(19)21)10-22-14-8-4-2-6-12(14)17;1-2/h1-8H,9-10H2,(H2,18,20);1-2H3.
What are the key properties of ethane;2-(2'-oxospiro[2H-1-benzofuran-3,3'-indole]-1'-yl)acetamide?
ethane;2-(2'-oxospiro[2H-1-benzofuran-3,3'-indole]-1'-yl)acetamide has a molecular weight of 324.38 g/mol, XLogP of 2.22, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-(2'-oxospiro[2H-1-benzofuran-3,3'-indole]-1'-yl)acetamide is sourced from PubChem (CID 91113408), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).