C13H13NO4 — CID 91113485
(3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl) 2-methylprop-2-enoate (PubChem CID 91113485) has the molecular formula C13H13NO4 and a molecular weight of 247.25 g/mol. Its IUPAC name is (3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl) 2-methylprop-2-enoate.
| Compound Name | (3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl) 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 91113485 |
| Molecular Formula | C13H13NO4 |
| Molecular Weight | 247.25 g/mol |
| Exact Mass | 247.08 |
| IUPAC Name | (3,5-dihydroxy-4-azatricyclo[5.2.1.02,6]deca-2,5,8-trien-4-yl) 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)On1c(O)c2c(c1O)C1C=CC2C1 |
| InChI | InChI=1S/C13H13NO4/c1-6(2)13(17)18-14-11(15)9-7-3-4-8(5-7)10(9)12(14)16/h3-4,7-8,15-16H,1,5H2,2H3 |
| InChIKey | SGYQCWYSUOKYSR-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 71.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.25 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|