About 4-tert-butyl-7-methyl-2,3-dihydrofuro[3,2-c]pyridine
4-tert-butyl-7-methyl-2,3-dihydrofuro[3,2-c]pyridine (PubChem CID 91113567) has the molecular formula C12H17NO
and a molecular weight of 191.27 g/mol. Its IUPAC name is 4-tert-butyl-7-methyl-2,3-dihydrofuro[3,2-c]pyridine.
Molecular Properties
| Compound Name | 4-tert-butyl-7-methyl-2,3-dihydrofuro[3,2-c]pyridine |
| PubChem CID | 91113567 |
| Molecular Formula | C12H17NO |
| Molecular Weight | 191.27 g/mol |
| Exact Mass | 191.13 |
| IUPAC Name | 4-tert-butyl-7-methyl-2,3-dihydrofuro[3,2-c]pyridine |
| SMILES | Cc1cnc(C(C)(C)C)c2c1OCC2 |
| InChI | InChI=1S/C12H17NO/c1-8-7-13-11(12(2,3)4)9-5-6-14-10(8)9/h7H,5-6H2,1-4H3 |
| InChIKey | XQBQWPKVRIIQQQ-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.27 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-tert-butyl-7-methyl-2,3-dihydrofuro[3,2-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-tert-butyl-7-methyl-2,3-dihydrofuro[3,2-c]pyridine?
The IUPAC name of 4-tert-butyl-7-methyl-2,3-dihydrofuro[3,2-c]pyridine (CID 91113567) is 4-tert-butyl-7-methyl-2,3-dihydrofuro[3,2-c]pyridine.
What is the SMILES notation for 4-tert-butyl-7-methyl-2,3-dihydrofuro[3,2-c]pyridine?
The canonical SMILES for 4-tert-butyl-7-methyl-2,3-dihydrofuro[3,2-c]pyridine is Cc1cnc(C(C)(C)C)c2c1OCC2.
What is the InChIKey of 4-tert-butyl-7-methyl-2,3-dihydrofuro[3,2-c]pyridine?
The InChIKey is XQBQWPKVRIIQQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H17NO/c1-8-7-13-11(12(2,3)4)9-5-6-14-10(8)9/h7H,5-6H2,1-4H3.
What are the key properties of 4-tert-butyl-7-methyl-2,3-dihydrofuro[3,2-c]pyridine?
4-tert-butyl-7-methyl-2,3-dihydrofuro[3,2-c]pyridine has a molecular weight of 191.27 g/mol, XLogP of 2.62, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-tert-butyl-7-methyl-2,3-dihydrofuro[3,2-c]pyridine is sourced from PubChem (CID 91113567), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).