About 2-bromo-6-(1,7,7-trimethyl-2-bicyclo[2.2.1]hept-2-enyl)pyridine
2-bromo-6-(1,7,7-trimethyl-2-bicyclo[2.2.1]hept-2-enyl)pyridine (PubChem CID 91113610) has the molecular formula C15H18BrN
and a molecular weight of 292.22 g/mol. Its IUPAC name is 2-bromo-6-(1,7,7-trimethyl-2-bicyclo[2.2.1]hept-2-enyl)pyridine.
Molecular Properties
| Compound Name | 2-bromo-6-(1,7,7-trimethyl-2-bicyclo[2.2.1]hept-2-enyl)pyridine |
| PubChem CID | 91113610 |
| Molecular Formula | C15H18BrN |
| Molecular Weight | 292.22 g/mol |
| Exact Mass | 291.06 |
| IUPAC Name | 2-bromo-6-(1,7,7-trimethyl-2-bicyclo[2.2.1]hept-2-enyl)pyridine |
| SMILES | CC12CCC(C=C1c1cccc(Br)n1)C2(C)C |
| InChI | InChI=1S/C15H18BrN/c1-14(2)10-7-8-15(14,3)11(9-10)12-5-4-6-13(16)17-12/h4-6,9-10H,7-8H2,1-3H3 |
| InChIKey | RILUNZOOKBZSQU-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.22 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-6-(1,7,7-trimethyl-2-bicyclo[2.2.1]hept-2-enyl)pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-6-(1,7,7-trimethyl-2-bicyclo[2.2.1]hept-2-enyl)pyridine?
The IUPAC name of 2-bromo-6-(1,7,7-trimethyl-2-bicyclo[2.2.1]hept-2-enyl)pyridine (CID 91113610) is 2-bromo-6-(1,7,7-trimethyl-2-bicyclo[2.2.1]hept-2-enyl)pyridine.
What is the SMILES notation for 2-bromo-6-(1,7,7-trimethyl-2-bicyclo[2.2.1]hept-2-enyl)pyridine?
The canonical SMILES for 2-bromo-6-(1,7,7-trimethyl-2-bicyclo[2.2.1]hept-2-enyl)pyridine is CC12CCC(C=C1c1cccc(Br)n1)C2(C)C.
What is the InChIKey of 2-bromo-6-(1,7,7-trimethyl-2-bicyclo[2.2.1]hept-2-enyl)pyridine?
The InChIKey is RILUNZOOKBZSQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H18BrN/c1-14(2)10-7-8-15(14,3)11(9-10)12-5-4-6-13(16)17-12/h4-6,9-10H,7-8H2,1-3H3.
What are the key properties of 2-bromo-6-(1,7,7-trimethyl-2-bicyclo[2.2.1]hept-2-enyl)pyridine?
2-bromo-6-(1,7,7-trimethyl-2-bicyclo[2.2.1]hept-2-enyl)pyridine has a molecular weight of 292.22 g/mol, XLogP of 4.68, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-6-(1,7,7-trimethyl-2-bicyclo[2.2.1]hept-2-enyl)pyridine is sourced from PubChem (CID 91113610), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).