About acetaldehyde;cyclopropanamine;methoxymethoxymethylidene(triphenyl)-λ5-phosphane
acetaldehyde;cyclopropanamine;methoxymethoxymethylidene(triphenyl)-λ5-phosphane (PubChem CID 91113710) has the molecular formula C26H32NO3P
and a molecular weight of 437.52 g/mol. Its IUPAC name is acetaldehyde;cyclopropanamine;methoxymethoxymethylidene(triphenyl)-λ5-phosphane.
Molecular Properties
| Compound Name | acetaldehyde;cyclopropanamine;methoxymethoxymethylidene(triphenyl)-λ5-phosphane |
| PubChem CID | 91113710 |
| Molecular Formula | C26H32NO3P |
| Molecular Weight | 437.52 g/mol |
| Exact Mass | 437.21 |
| IUPAC Name | acetaldehyde;cyclopropanamine;methoxymethoxymethylidene(triphenyl)-λ5-phosphane |
| SMILES | CC=O.COCOC=P(c1ccccc1)(c1ccccc1)c1ccccc1.NC1CC1 |
| InChI | InChI=1S/C21H21O2P.C3H7N.C2H4O/c1-22-17-23-18-24(19-11-5-2-6-12-19,20-13-7-3-8-14-20)21-15-9-4-10-16-21;4-3-1-2-3;1-2-3/h2-16,18H,17H2,1H3;3H,1-2,4H2;2H,1H3 |
| InChIKey | KUBGKIYDJGPSTR-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 61.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 437.52 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze acetaldehyde;cyclopropanamine;methoxymethoxymethylidene(triphenyl)-λ5-phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetaldehyde;cyclopropanamine;methoxymethoxymethylidene(triphenyl)-λ5-phosphane?
The IUPAC name of acetaldehyde;cyclopropanamine;methoxymethoxymethylidene(triphenyl)-λ5-phosphane (CID 91113710) is acetaldehyde;cyclopropanamine;methoxymethoxymethylidene(triphenyl)-λ5-phosphane.
What is the SMILES notation for acetaldehyde;cyclopropanamine;methoxymethoxymethylidene(triphenyl)-λ5-phosphane?
The canonical SMILES for acetaldehyde;cyclopropanamine;methoxymethoxymethylidene(triphenyl)-λ5-phosphane is CC=O.COCOC=P(c1ccccc1)(c1ccccc1)c1ccccc1.NC1CC1.
What is the InChIKey of acetaldehyde;cyclopropanamine;methoxymethoxymethylidene(triphenyl)-λ5-phosphane?
The InChIKey is KUBGKIYDJGPSTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H21O2P.C3H7N.C2H4O/c1-22-17-23-18-24(19-11-5-2-6-12-19,20-13-7-3-8-14-20)21-15-9-4-10-16-21;4-3-1-2-3;1-2-3/h2-16,18H,17H2,1H3;3H,1-2,4H2;2H,1H3.
What are the key properties of acetaldehyde;cyclopropanamine;methoxymethoxymethylidene(triphenyl)-λ5-phosphane?
acetaldehyde;cyclopropanamine;methoxymethoxymethylidene(triphenyl)-λ5-phosphane has a molecular weight of 437.52 g/mol, XLogP of 3.67, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for acetaldehyde;cyclopropanamine;methoxymethoxymethylidene(triphenyl)-λ5-phosphane is sourced from PubChem (CID 91113710), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).