C11H23N13O — CID 91114157
1-azido-2-(azidomethyl)butan-2-amine;2,2-bis(azidomethyl)butan-1-ol (PubChem CID 91114157) has the molecular formula C11H23N13O and a molecular weight of 353.40 g/mol. Its IUPAC name is 1-azido-2-(azidomethyl)butan-2-amine;2,2-bis(azidomethyl)butan-1-ol.
| Compound Name | 1-azido-2-(azidomethyl)butan-2-amine;2,2-bis(azidomethyl)butan-1-ol |
|---|---|
| PubChem CID | 91114157 |
| Molecular Formula | C11H23N13O |
| Molecular Weight | 353.40 g/mol |
| Exact Mass | 353.21 |
| IUPAC Name | 1-azido-2-(azidomethyl)butan-2-amine;2,2-bis(azidomethyl)butan-1-ol |
| SMILES | CCC(CO)(CN=[N+]=[N-])CN=[N+]=[N-].CCC(N)(CN=[N+]=[N-])CN=[N+]=[N-] |
| InChI | InChI=1S/C6H12N6O.C5H11N7/c1-2-6(5-13,3-9-11-7)4-10-12-8;1-2-5(6,3-9-11-7)4-10-12-8/h13H,2-5H2,1H3;2-4,6H2,1H3 |
| InChIKey | NWQCOLNVHUGIRP-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 241.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.40 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|