C16H22BrN5O3S — CID 91114393
(2R,3R)-3-[[2-[4-(amino-methylidene-oxo-λ6-sulfanyl)anilino]-5-bromopyrimidin-4-yl]amino]-4-methoxybutan-2-ol (PubChem CID 91114393) has the molecular formula C16H22BrN5O3S and a molecular weight of 444.36 g/mol. Its IUPAC name is (2R,3R)-3-[[2-[4-(amino-methylidene-oxo-λ6-sulfanyl)anilino]-5-bromopyrimidin-4-yl]amino]-4-methoxybutan-2-ol.
| Compound Name | (2R,3R)-3-[[2-[4-(amino-methylidene-oxo-λ6-sulfanyl)anilino]-5-bromopyrimidin-4-yl]amino]-4-methoxybutan-2-ol |
|---|---|
| PubChem CID | 91114393 |
| Molecular Formula | C16H22BrN5O3S |
| Molecular Weight | 444.36 g/mol |
| Exact Mass | 443.06 |
| IUPAC Name | (2R,3R)-3-[[2-[4-(amino-methylidene-oxo-λ6-sulfanyl)anilino]-5-bromopyrimidin-4-yl]amino]-4-methoxybutan-2-ol |
| SMILES | C=S(N)(=O)c1ccc(Nc2ncc(Br)c(N[C@H](COC)[C@@H](C)O)n2)cc1 |
| InChI | InChI=1S/C16H22BrN5O3S/c1-10(23)14(9-25-2)21-15-13(17)8-19-16(22-15)20-11-4-6-12(7-5-11)26(3,18)24/h4-8,10,14,23H,3,9H2,1-2H3,(H2,18,24)(H2,19,20,21,22)/t10-,14-,26?/m1/s1 |
| InChIKey | AITHXHFWEJLEEC-VXMTXHJISA-N |
| XLogP | 1.74 |
| TPSA | 122.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.36 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|