C11H13NSi — CID 91114550
4,8,8-trimethyl-9-methylidene-3-aza-8-silatricyclo[5.1.1.02,6]nona-1,4,6-triene (PubChem CID 91114550) has the molecular formula C11H13NSi and a molecular weight of 187.32 g/mol. Its IUPAC name is 4,8,8-trimethyl-9-methylidene-3-aza-8-silatricyclo[5.1.1.02,6]nona-1,4,6-triene.
| Compound Name | 4,8,8-trimethyl-9-methylidene-3-aza-8-silatricyclo[5.1.1.02,6]nona-1,4,6-triene |
|---|---|
| PubChem CID | 91114550 |
| Molecular Formula | C11H13NSi |
| Molecular Weight | 187.32 g/mol |
| Exact Mass | 187.08 |
| IUPAC Name | 4,8,8-trimethyl-9-methylidene-3-aza-8-silatricyclo[5.1.1.02,6]nona-1,4,6-triene |
| SMILES | C=C1C2=c3cc(C)[nH]c3=C1[Si]2(C)C |
| InChI | InChI=1S/C11H13NSi/c1-6-5-8-9(12-6)11-7(2)10(8)13(11,3)4/h5,12H,2H2,1,3-4H3 |
| InChIKey | KNOSFXCIHNUCET-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.32 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|