C16H24O7 — CID 91114582
2-hydroxy-6,10-dimethylundeca-5,9-diene-1,2,3-tricarboxylic acid (PubChem CID 91114582) has the molecular formula C16H24O7 and a molecular weight of 328.36 g/mol. Its IUPAC name is 2-hydroxy-6,10-dimethylundeca-5,9-diene-1,2,3-tricarboxylic acid.
| Compound Name | 2-hydroxy-6,10-dimethylundeca-5,9-diene-1,2,3-tricarboxylic acid |
|---|---|
| PubChem CID | 91114582 |
| Molecular Formula | C16H24O7 |
| Molecular Weight | 328.36 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | 2-hydroxy-6,10-dimethylundeca-5,9-diene-1,2,3-tricarboxylic acid |
| SMILES | CC(C)=CCCC(C)=CCC(C(=O)O)C(O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C16H24O7/c1-10(2)5-4-6-11(3)7-8-12(14(19)20)16(23,15(21)22)9-13(17)18/h5,7,12,23H,4,6,8-9H2,1-3H3,(H,17,18)(H,19,20)(H,21,22) |
| InChIKey | QAWFXXRXWQSPOY-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 132.13 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.36 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|