About cyclopropylcyclononane
cyclopropylcyclononane (PubChem CID 91114630) has the molecular formula C12H22
and a molecular weight of 166.31 g/mol. Its IUPAC name is cyclopropylcyclononane.
Molecular Properties
| Compound Name | cyclopropylcyclononane |
| PubChem CID | 91114630 |
| Molecular Formula | C12H22 |
| Molecular Weight | 166.31 g/mol |
| Exact Mass | 166.17 |
| IUPAC Name | cyclopropylcyclononane |
| SMILES | C1CCCCC(C2CC2)CCC1 |
| InChI | InChI=1S/C12H22/c1-2-4-6-8-11(7-5-3-1)12-9-10-12/h11-12H,1-10H2 |
| InChIKey | VZNUCNBBMILNDO-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.31 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze cyclopropylcyclononane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopropylcyclononane?
The IUPAC name of cyclopropylcyclononane (CID 91114630) is cyclopropylcyclononane.
What is the SMILES notation for cyclopropylcyclononane?
The canonical SMILES for cyclopropylcyclononane is C1CCCCC(C2CC2)CCC1.
What is the InChIKey of cyclopropylcyclononane?
The InChIKey is VZNUCNBBMILNDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22/c1-2-4-6-8-11(7-5-3-1)12-9-10-12/h11-12H,1-10H2.
What are the key properties of cyclopropylcyclononane?
cyclopropylcyclononane has a molecular weight of 166.31 g/mol, XLogP of 4.15, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopropylcyclononane is sourced from PubChem (CID 91114630), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).