C24H26ClN7O5S2 — CID 91115496
2-[3-[2-(4-chlorophenyl)ethenylsulfonylamino]-2-oxo-1-pyridinyl]-N-[(2S)-5-(diaminomethylideneamino)-1-oxo-1-(1,3-thiazol-2-yl)pentan-2-yl]acetamide (PubChem CID 91115496) has the molecular formula C24H26ClN7O5S2 and a molecular weight of 592.10 g/mol. Its IUPAC name is 2-[3-[2-(4-chlorophenyl)ethenylsulfonylamino]-2-oxo-1-pyridinyl]-N-[(2S)-5-(diaminomethylideneamino)-1-oxo-1-(1,3-thiazol-2-yl)pentan-2-yl]acetamide.
| Compound Name | 2-[3-[2-(4-chlorophenyl)ethenylsulfonylamino]-2-oxo-1-pyridinyl]-N-[(2S)-5-(diaminomethylideneamino)-1-oxo-1-(1,3-thiazol-2-yl)pentan-2-yl]acetamide |
|---|---|
| PubChem CID | 91115496 |
| Molecular Formula | C24H26ClN7O5S2 |
| Molecular Weight | 592.10 g/mol |
| Exact Mass | 591.11 |
| IUPAC Name | 2-[3-[2-(4-chlorophenyl)ethenylsulfonylamino]-2-oxo-1-pyridinyl]-N-[(2S)-5-(diaminomethylideneamino)-1-oxo-1-(1,3-thiazol-2-yl)pentan-2-yl]acetamide |
| SMILES | NC(N)=NCCC[C@H](NC(=O)Cn1cccc(NS(=O)(=O)C=Cc2ccc(Cl)cc2)c1=O)C(=O)c1nccs1 |
| InChI | InChI=1S/C24H26ClN7O5S2/c25-17-7-5-16(6-8-17)9-14-39(36,37)31-19-4-2-12-32(23(19)35)15-20(33)30-18(3-1-10-29-24(26)27)21(34)22-28-11-13-38-22/h2,4-9,11-14,18,31H,1,3,10,15H2,(H,30,33)(H4,26,27,29)/t18-/m0/s1 |
| InChIKey | QBQLTJCQRMUFFN-SFHVURJKSA-N |
| XLogP | 1.79 |
| TPSA | 191.63 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 592.10 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|