C13H19N — CID 91115506
2-cyclopropyl-N,4,4-trimethylcyclohepta-2,6-dien-1-imine (PubChem CID 91115506) has the molecular formula C13H19N and a molecular weight of 189.30 g/mol. Its IUPAC name is 2-cyclopropyl-N,4,4-trimethylcyclohepta-2,6-dien-1-imine.
| Compound Name | 2-cyclopropyl-N,4,4-trimethylcyclohepta-2,6-dien-1-imine |
|---|---|
| PubChem CID | 91115506 |
| Molecular Formula | C13H19N |
| Molecular Weight | 189.30 g/mol |
| Exact Mass | 189.15 |
| IUPAC Name | 2-cyclopropyl-N,4,4-trimethylcyclohepta-2,6-dien-1-imine |
| SMILES | C/N=C1\C=CCC(C)(C)C=C1C1CC1 |
| InChI | InChI=1S/C13H19N/c1-13(2)8-4-5-12(14-3)11(9-13)10-6-7-10/h4-5,9-10H,6-8H2,1-3H3/b14-12+ |
| InChIKey | GUFBHDKOGOVAPN-WYMLVPIESA-N |
| XLogP | 3.38 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.30 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|