C15H25NO3 — CID 91115514
(3S,7aS)-3-tert-butyl-7-hydroxy-7,7a-dimethyl-6-prop-2-enyl-3,6-dihydro-1H-pyrrolo[1,2-c][1,3]oxazol-5-one (PubChem CID 91115514) has the molecular formula C15H25NO3 and a molecular weight of 267.37 g/mol. Its IUPAC name is (3S,7aS)-3-tert-butyl-7-hydroxy-7,7a-dimethyl-6-prop-2-enyl-3,6-dihydro-1H-pyrrolo[1,2-c][1,3]oxazol-5-one.
| Compound Name | (3S,7aS)-3-tert-butyl-7-hydroxy-7,7a-dimethyl-6-prop-2-enyl-3,6-dihydro-1H-pyrrolo[1,2-c][1,3]oxazol-5-one |
|---|---|
| PubChem CID | 91115514 |
| Molecular Formula | C15H25NO3 |
| Molecular Weight | 267.37 g/mol |
| Exact Mass | 267.18 |
| IUPAC Name | (3S,7aS)-3-tert-butyl-7-hydroxy-7,7a-dimethyl-6-prop-2-enyl-3,6-dihydro-1H-pyrrolo[1,2-c][1,3]oxazol-5-one |
| SMILES | C=CCC1C(=O)N2[C@H](C(C)(C)C)OC[C@@]2(C)C1(C)O |
| InChI | InChI=1S/C15H25NO3/c1-7-8-10-11(17)16-12(13(2,3)4)19-9-14(16,5)15(10,6)18/h7,10,12,18H,1,8-9H2,2-6H3/t10?,12-,14-,15?/m0/s1 |
| InChIKey | GMNXFTQYBSNLJE-VKAVAODPSA-N |
| XLogP | 1.93 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.37 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|