About 4-[2-[N,4-dimethyl-3-[1,3-oxazol-2-yl(pyridin-4-yl)amino]anilino]acetyl]benzonitrile
4-[2-[N,4-dimethyl-3-[1,3-oxazol-2-yl(pyridin-4-yl)amino]anilino]acetyl]benzonitrile (PubChem CID 91115942) has the molecular formula C25H21N5O2
and a molecular weight of 423.48 g/mol. Its IUPAC name is 4-[2-[N,4-dimethyl-3-[1,3-oxazol-2-yl(pyridin-4-yl)amino]anilino]acetyl]benzonitrile.
Molecular Properties
| Compound Name | 4-[2-[N,4-dimethyl-3-[1,3-oxazol-2-yl(pyridin-4-yl)amino]anilino]acetyl]benzonitrile |
| PubChem CID | 91115942 |
| Molecular Formula | C25H21N5O2 |
| Molecular Weight | 423.48 g/mol |
| Exact Mass | 423.17 |
| IUPAC Name | 4-[2-[N,4-dimethyl-3-[1,3-oxazol-2-yl(pyridin-4-yl)amino]anilino]acetyl]benzonitrile |
| SMILES | Cc1ccc(N(C)CC(=O)c2ccc(C#N)cc2)cc1N(c1ccncc1)c1ncco1 |
| InChI | InChI=1S/C25H21N5O2/c1-18-3-8-22(29(2)17-24(31)20-6-4-19(16-26)5-7-20)15-23(18)30(25-28-13-14-32-25)21-9-11-27-12-10-21/h3-15H,17H2,1-2H3 |
| InChIKey | NWLVRQSMLWNRDL-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 86.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 423.48 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 4-[2-[N,4-dimethyl-3-[1,3-oxazol-2-yl(pyridin-4-yl)amino]anilino]acetyl]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-[N,4-dimethyl-3-[1,3-oxazol-2-yl(pyridin-4-yl)amino]anilino]acetyl]benzonitrile?
The IUPAC name of 4-[2-[N,4-dimethyl-3-[1,3-oxazol-2-yl(pyridin-4-yl)amino]anilino]acetyl]benzonitrile (CID 91115942) is 4-[2-[N,4-dimethyl-3-[1,3-oxazol-2-yl(pyridin-4-yl)amino]anilino]acetyl]benzonitrile.
What is the SMILES notation for 4-[2-[N,4-dimethyl-3-[1,3-oxazol-2-yl(pyridin-4-yl)amino]anilino]acetyl]benzonitrile?
The canonical SMILES for 4-[2-[N,4-dimethyl-3-[1,3-oxazol-2-yl(pyridin-4-yl)amino]anilino]acetyl]benzonitrile is Cc1ccc(N(C)CC(=O)c2ccc(C#N)cc2)cc1N(c1ccncc1)c1ncco1.
What is the InChIKey of 4-[2-[N,4-dimethyl-3-[1,3-oxazol-2-yl(pyridin-4-yl)amino]anilino]acetyl]benzonitrile?
The InChIKey is NWLVRQSMLWNRDL-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H21N5O2/c1-18-3-8-22(29(2)17-24(31)20-6-4-19(16-26)5-7-20)15-23(18)30(25-28-13-14-32-25)21-9-11-27-12-10-21/h3-15H,17H2,1-2H3.
What are the key properties of 4-[2-[N,4-dimethyl-3-[1,3-oxazol-2-yl(pyridin-4-yl)amino]anilino]acetyl]benzonitrile?
4-[2-[N,4-dimethyl-3-[1,3-oxazol-2-yl(pyridin-4-yl)amino]anilino]acetyl]benzonitrile has a molecular weight of 423.48 g/mol, XLogP of 5.04, 7 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-[N,4-dimethyl-3-[1,3-oxazol-2-yl(pyridin-4-yl)amino]anilino]acetyl]benzonitrile is sourced from PubChem (CID 91115942), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).