C32H34N2O4 — CID 91116090
4-[[6-methoxy-1-[4-(2-piperidin-1-ylethoxy)phenoxy]naphthalen-2-yl]methyl]benzamide (PubChem CID 91116090) has the molecular formula C32H34N2O4 and a molecular weight of 510.63 g/mol. Its IUPAC name is 4-[[6-methoxy-1-[4-(2-piperidin-1-ylethoxy)phenoxy]naphthalen-2-yl]methyl]benzamide.
| Compound Name | 4-[[6-methoxy-1-[4-(2-piperidin-1-ylethoxy)phenoxy]naphthalen-2-yl]methyl]benzamide |
|---|---|
| PubChem CID | 91116090 |
| Molecular Formula | C32H34N2O4 |
| Molecular Weight | 510.63 g/mol |
| Exact Mass | 510.25 |
| IUPAC Name | 4-[[6-methoxy-1-[4-(2-piperidin-1-ylethoxy)phenoxy]naphthalen-2-yl]methyl]benzamide |
| SMILES | COc1ccc2c(Oc3ccc(OCCN4CCCCC4)cc3)c(Cc3ccc(C(N)=O)cc3)ccc2c1 |
| InChI | InChI=1S/C32H34N2O4/c1-36-29-15-16-30-25(22-29)9-10-26(21-23-5-7-24(8-6-23)32(33)35)31(30)38-28-13-11-27(12-14-28)37-20-19-34-17-3-2-4-18-34/h5-16,22H,2-4,17-21H2,1H3,(H2,33,35) |
| InChIKey | DHLWGSNPCACBBE-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 74.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.63 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |