About 1-(disulfanyl)imidazo[4,5-c]pyridine
1-(disulfanyl)imidazo[4,5-c]pyridine (PubChem CID 91116326) has the molecular formula C6H5N3S2
and a molecular weight of 183.26 g/mol. Its IUPAC name is 1-(disulfanyl)imidazo[4,5-c]pyridine.
Molecular Properties
| Compound Name | 1-(disulfanyl)imidazo[4,5-c]pyridine |
| PubChem CID | 91116326 |
| Molecular Formula | C6H5N3S2 |
| Molecular Weight | 183.26 g/mol |
| Exact Mass | 182.99 |
| IUPAC Name | 1-(disulfanyl)imidazo[4,5-c]pyridine |
| SMILES | SSn1cnc2cnccc21 |
| InChI | InChI=1S/C6H5N3S2/c10-11-9-4-8-5-3-7-2-1-6(5)9/h1-4,10H |
| InChIKey | GBMPJEGDNNWUQP-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 30.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.26 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 1-(disulfanyl)imidazo[4,5-c]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(disulfanyl)imidazo[4,5-c]pyridine?
The IUPAC name of 1-(disulfanyl)imidazo[4,5-c]pyridine (CID 91116326) is 1-(disulfanyl)imidazo[4,5-c]pyridine.
What is the SMILES notation for 1-(disulfanyl)imidazo[4,5-c]pyridine?
The canonical SMILES for 1-(disulfanyl)imidazo[4,5-c]pyridine is SSn1cnc2cnccc21.
What is the InChIKey of 1-(disulfanyl)imidazo[4,5-c]pyridine?
The InChIKey is GBMPJEGDNNWUQP-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5N3S2/c10-11-9-4-8-5-3-7-2-1-6(5)9/h1-4,10H.
What are the key properties of 1-(disulfanyl)imidazo[4,5-c]pyridine?
1-(disulfanyl)imidazo[4,5-c]pyridine has a molecular weight of 183.26 g/mol, XLogP of 1.77, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(disulfanyl)imidazo[4,5-c]pyridine is sourced from PubChem (CID 91116326), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).