C34H46N2O8 — CID 91116361
methyl (2R,4S,7S)-7-tert-butyl-18-methoxy-2-(methoxymethoxy)-13,13-dimethyl-6,9-dioxo-10-oxa-5,8-diazatetracyclo[15.5.3.12,5.020,24]hexacosa-1(23),15,17,19,21,24-hexaene-4-carboxylate (PubChem CID 91116361) has the molecular formula C34H46N2O8 and a molecular weight of 610.75 g/mol. Its IUPAC name is methyl (2R,4S,7S)-7-tert-butyl-18-methoxy-2-(methoxymethoxy)-13,13-dimethyl-6,9-dioxo-10-oxa-5,8-diazatetracyclo[15.5.3.12,5.020,24]hexacosa-1(23),15,17,19,21,24-hexaene-4-carboxylate.
| Compound Name | methyl (2R,4S,7S)-7-tert-butyl-18-methoxy-2-(methoxymethoxy)-13,13-dimethyl-6,9-dioxo-10-oxa-5,8-diazatetracyclo[15.5.3.12,5.020,24]hexacosa-1(23),15,17,19,21,24-hexaene-4-carboxylate |
|---|---|
| PubChem CID | 91116361 |
| Molecular Formula | C34H46N2O8 |
| Molecular Weight | 610.75 g/mol |
| Exact Mass | 610.33 |
| IUPAC Name | methyl (2R,4S,7S)-7-tert-butyl-18-methoxy-2-(methoxymethoxy)-13,13-dimethyl-6,9-dioxo-10-oxa-5,8-diazatetracyclo[15.5.3.12,5.020,24]hexacosa-1(23),15,17,19,21,24-hexaene-4-carboxylate |
| SMILES | COCO[C@@]12C[C@@H](C(=O)OC)N(C1)C(=O)[C@H](C(C)(C)C)NC(=O)OCCC(C)(C)CC=Cc1cc3cc2ccc3cc1OC |
| InChI | InChI=1S/C34H46N2O8/c1-32(2,3)28-29(37)36-20-34(44-21-40-6,19-26(36)30(38)42-8)25-12-11-22-18-27(41-7)23(16-24(22)17-25)10-9-13-33(4,5)14-15-43-31(39)35-28/h9-12,16-18,26,28H,13-15,19-21H2,1-8H3,(H,35,39)/t26-,28+,34-/m0/s1 |
| InChIKey | ACJQACVCMAKXHW-HOFKBBIZSA-N |
| XLogP | 5.41 |
| TPSA | 112.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 610.75 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|