About 2-ethylidene-4,4-dimethyl-3-propan-2-ylidenethiolane 1,1-dioxide
2-ethylidene-4,4-dimethyl-3-propan-2-ylidenethiolane 1,1-dioxide (PubChem CID 91116543) has the molecular formula C11H18O2S
and a molecular weight of 214.33 g/mol. Its IUPAC name is 2-ethylidene-4,4-dimethyl-3-propan-2-ylidenethiolane 1,1-dioxide.
Analyze 2-ethylidene-4,4-dimethyl-3-propan-2-ylidenethiolane 1,1-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylidene-4,4-dimethyl-3-propan-2-ylidenethiolane 1,1-dioxide?
The IUPAC name of 2-ethylidene-4,4-dimethyl-3-propan-2-ylidenethiolane 1,1-dioxide (CID 91116543) is 2-ethylidene-4,4-dimethyl-3-propan-2-ylidenethiolane 1,1-dioxide.
What is the SMILES notation for 2-ethylidene-4,4-dimethyl-3-propan-2-ylidenethiolane 1,1-dioxide?
The canonical SMILES for 2-ethylidene-4,4-dimethyl-3-propan-2-ylidenethiolane 1,1-dioxide is CC=C1C(=C(C)C)C(C)(C)CS1(=O)=O.
What is the InChIKey of 2-ethylidene-4,4-dimethyl-3-propan-2-ylidenethiolane 1,1-dioxide?
The InChIKey is KXEDODXNPOJXQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18O2S/c1-6-9-10(8(2)3)11(4,5)7-14(9,12)13/h6H,7H2,1-5H3.
What are the key properties of 2-ethylidene-4,4-dimethyl-3-propan-2-ylidenethiolane 1,1-dioxide?
2-ethylidene-4,4-dimethyl-3-propan-2-ylidenethiolane 1,1-dioxide has a molecular weight of 214.33 g/mol, XLogP of 2.68, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylidene-4,4-dimethyl-3-propan-2-ylidenethiolane 1,1-dioxide is sourced from PubChem (CID 91116543), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).