About cyclopenta-1,3-diene;ethane;5-ethyl-5-methylcyclopenta-1,3-diene
cyclopenta-1,3-diene;ethane;5-ethyl-5-methylcyclopenta-1,3-diene (PubChem CID 91116862) has the molecular formula C21H42
and a molecular weight of 294.57 g/mol. Its IUPAC name is cyclopenta-1,3-diene;ethane;5-ethyl-5-methylcyclopenta-1,3-diene.
Molecular Properties
| Compound Name | cyclopenta-1,3-diene;ethane;5-ethyl-5-methylcyclopenta-1,3-diene |
| PubChem CID | 91116862 |
| Molecular Formula | C21H42 |
| Molecular Weight | 294.57 g/mol |
| Exact Mass | 294.33 |
| IUPAC Name | cyclopenta-1,3-diene;ethane;5-ethyl-5-methylcyclopenta-1,3-diene |
| SMILES | C1=CCC=C1.CC.CC.CC.CC.CCC1(C)C=CC=C1 |
| InChI | InChI=1S/C8H12.C5H6.4C2H6/c1-3-8(2)6-4-5-7-8;1-2-4-5-3-1;4*1-2/h4-7H,3H2,1-2H3;1-4H,5H2;4*1-2H3 |
| InChIKey | MILUXMBMZLMIKE-UHFFFAOYSA-N |
| XLogP | 8.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 294.57 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze cyclopenta-1,3-diene;ethane;5-ethyl-5-methylcyclopenta-1,3-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopenta-1,3-diene;ethane;5-ethyl-5-methylcyclopenta-1,3-diene?
The IUPAC name of cyclopenta-1,3-diene;ethane;5-ethyl-5-methylcyclopenta-1,3-diene (CID 91116862) is cyclopenta-1,3-diene;ethane;5-ethyl-5-methylcyclopenta-1,3-diene.
What is the SMILES notation for cyclopenta-1,3-diene;ethane;5-ethyl-5-methylcyclopenta-1,3-diene?
The canonical SMILES for cyclopenta-1,3-diene;ethane;5-ethyl-5-methylcyclopenta-1,3-diene is C1=CCC=C1.CC.CC.CC.CC.CCC1(C)C=CC=C1.
What is the InChIKey of cyclopenta-1,3-diene;ethane;5-ethyl-5-methylcyclopenta-1,3-diene?
The InChIKey is MILUXMBMZLMIKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12.C5H6.4C2H6/c1-3-8(2)6-4-5-7-8;1-2-4-5-3-1;4*1-2/h4-7H,3H2,1-2H3;1-4H,5H2;4*1-2H3.
What are the key properties of cyclopenta-1,3-diene;ethane;5-ethyl-5-methylcyclopenta-1,3-diene?
cyclopenta-1,3-diene;ethane;5-ethyl-5-methylcyclopenta-1,3-diene has a molecular weight of 294.57 g/mol, XLogP of 8.14, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopenta-1,3-diene;ethane;5-ethyl-5-methylcyclopenta-1,3-diene is sourced from PubChem (CID 91116862), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).