C5H6Br2N2 — CID 911172
3,4-dibromo-1,5-dimethylpyrazole (PubChem CID 911172) has the molecular formula C5H6Br2N2 and a molecular weight of 253.92 g/mol. Its IUPAC name is 3,4-dibromo-1,5-dimethylpyrazole.
| Compound Name | 3,4-dibromo-1,5-dimethylpyrazole |
|---|---|
| PubChem CID | 911172 |
| Molecular Formula | C5H6Br2N2 |
| Molecular Weight | 253.92 g/mol |
| Exact Mass | 251.89 |
| IUPAC Name | 3,4-dibromo-1,5-dimethylpyrazole |
| SMILES | Cc1c(Br)c(Br)nn1C |
| InChI | InChI=1S/C5H6Br2N2/c1-3-4(6)5(7)8-9(3)2/h1-2H3 |
| InChIKey | LNWORINWPDQJGF-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.92 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |