C40H78 — CID 91117608
2-(2,3-diethylhexyl)-1-[11,11-dimethyl-3-(3-methyl-2-methylidenebutyl)-9-propylpentadecyl]-1-methylcyclopropane (PubChem CID 91117608) has the molecular formula C40H78 and a molecular weight of 559.06 g/mol. Its IUPAC name is 2-(2,3-diethylhexyl)-1-[11,11-dimethyl-3-(3-methyl-2-methylidenebutyl)-9-propylpentadecyl]-1-methylcyclopropane.
| Compound Name | 2-(2,3-diethylhexyl)-1-[11,11-dimethyl-3-(3-methyl-2-methylidenebutyl)-9-propylpentadecyl]-1-methylcyclopropane |
|---|---|
| PubChem CID | 91117608 |
| Molecular Formula | C40H78 |
| Molecular Weight | 559.06 g/mol |
| Exact Mass | 558.61 |
| IUPAC Name | 2-(2,3-diethylhexyl)-1-[11,11-dimethyl-3-(3-methyl-2-methylidenebutyl)-9-propylpentadecyl]-1-methylcyclopropane |
| SMILES | C=C(CC(CCCCCC(CCC)CC(C)(C)CCCC)CCC1(C)CC1CC(CC)C(CC)CCC)C(C)C |
| InChI | InChI=1S/C40H78/c1-12-17-26-39(9,10)30-35(21-13-2)24-20-18-19-23-34(28-33(8)32(6)7)25-27-40(11)31-38(40)29-37(16-5)36(15-4)22-14-3/h32,34-38H,8,12-31H2,1-7,9-11H3 |
| InChIKey | VQWPRUUXIMJTHM-UHFFFAOYSA-N |
| XLogP | 14.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 26 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.06 |
| LogP ≤ 5 | 14.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|