About cyclopenta-1,3-diene;ethoxyphosphane;isocyanomethane
cyclopenta-1,3-diene;ethoxyphosphane;isocyanomethane (PubChem CID 91117857) has the molecular formula C9H16NOP
and a molecular weight of 185.21 g/mol. Its IUPAC name is cyclopenta-1,3-diene;ethoxyphosphane;isocyanomethane.
Molecular Properties
| Compound Name | cyclopenta-1,3-diene;ethoxyphosphane;isocyanomethane |
| PubChem CID | 91117857 |
| Molecular Formula | C9H16NOP |
| Molecular Weight | 185.21 g/mol |
| Exact Mass | 185.10 |
| IUPAC Name | cyclopenta-1,3-diene;ethoxyphosphane;isocyanomethane |
| SMILES | C1=CCC=C1.CCOP.[C-]#[N+]C |
| InChI | InChI=1S/C5H6.C2H3N.C2H7OP/c1-2-4-5-3-1;1-3-2;1-2-3-4/h1-4H,5H2;1H3;2,4H2,1H3 |
| InChIKey | BOAHXZYKLTYFLX-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 13.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.21 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze cyclopenta-1,3-diene;ethoxyphosphane;isocyanomethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclopenta-1,3-diene;ethoxyphosphane;isocyanomethane?
The IUPAC name of cyclopenta-1,3-diene;ethoxyphosphane;isocyanomethane (CID 91117857) is cyclopenta-1,3-diene;ethoxyphosphane;isocyanomethane.
What is the SMILES notation for cyclopenta-1,3-diene;ethoxyphosphane;isocyanomethane?
The canonical SMILES for cyclopenta-1,3-diene;ethoxyphosphane;isocyanomethane is C1=CCC=C1.CCOP.[C-]#[N+]C.
What is the InChIKey of cyclopenta-1,3-diene;ethoxyphosphane;isocyanomethane?
The InChIKey is BOAHXZYKLTYFLX-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6.C2H3N.C2H7OP/c1-2-4-5-3-1;1-3-2;1-2-3-4/h1-4H,5H2;1H3;2,4H2,1H3.
What are the key properties of cyclopenta-1,3-diene;ethoxyphosphane;isocyanomethane?
cyclopenta-1,3-diene;ethoxyphosphane;isocyanomethane has a molecular weight of 185.21 g/mol, XLogP of 2.85, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for cyclopenta-1,3-diene;ethoxyphosphane;isocyanomethane is sourced from PubChem (CID 91117857), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).