C21H23Cl2NO7S — CID 91118350
4-[4-[(2,4-dichlorophenyl)methoxy]phenyl]sulfonyl-N,N-dihydroxy-2,2-dimethyloxane-3-carboxamide (PubChem CID 91118350) has the molecular formula C21H23Cl2NO7S and a molecular weight of 504.39 g/mol. Its IUPAC name is 4-[4-[(2,4-dichlorophenyl)methoxy]phenyl]sulfonyl-N,N-dihydroxy-2,2-dimethyloxane-3-carboxamide.
| Compound Name | 4-[4-[(2,4-dichlorophenyl)methoxy]phenyl]sulfonyl-N,N-dihydroxy-2,2-dimethyloxane-3-carboxamide |
|---|---|
| PubChem CID | 91118350 |
| Molecular Formula | C21H23Cl2NO7S |
| Molecular Weight | 504.39 g/mol |
| Exact Mass | 503.06 |
| IUPAC Name | 4-[4-[(2,4-dichlorophenyl)methoxy]phenyl]sulfonyl-N,N-dihydroxy-2,2-dimethyloxane-3-carboxamide |
| SMILES | CC1(C)OCCC(S(=O)(=O)c2ccc(OCc3ccc(Cl)cc3Cl)cc2)C1C(=O)N(O)O |
| InChI | InChI=1S/C21H23Cl2NO7S/c1-21(2)19(20(25)24(26)27)18(9-10-31-21)32(28,29)16-7-5-15(6-8-16)30-12-13-3-4-14(22)11-17(13)23/h3-8,11,18-19,26-27H,9-10,12H2,1-2H3 |
| InChIKey | QWYYZCZOGJSVGH-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 113.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.39 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|