C14H22N+ — CID 91118509
methyl-propan-2-ylidene-(3,3,7-trimethylcyclohepta-1,4,6-trien-1-yl)azanium (PubChem CID 91118509) has the molecular formula C14H22N+ and a molecular weight of 204.34 g/mol. Its IUPAC name is methyl-propan-2-ylidene-(3,3,7-trimethylcyclohepta-1,4,6-trien-1-yl)azanium.
| Compound Name | methyl-propan-2-ylidene-(3,3,7-trimethylcyclohepta-1,4,6-trien-1-yl)azanium |
|---|---|
| PubChem CID | 91118509 |
| Molecular Formula | C14H22N+ |
| Molecular Weight | 204.34 g/mol |
| Exact Mass | 204.17 |
| IUPAC Name | methyl-propan-2-ylidene-(3,3,7-trimethylcyclohepta-1,4,6-trien-1-yl)azanium |
| SMILES | CC1=CC=CC(C)(C)C=C1[N+](C)=C(C)C |
| InChI | InChI=1S/C14H22N/c1-11(2)15(6)13-10-14(4,5)9-7-8-12(13)3/h7-10H,1-6H3/q+1 |
| InChIKey | MKJHXCFLVJZPPQ-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.34 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|