C8H10O5 — CID 91118729
(3aS,4R,5S,7aR)-4,5-dihydroxy-7-methyl-3a,4,5,7a-tetrahydro-1,3-benzodioxol-2-one (PubChem CID 91118729) has the molecular formula C8H10O5 and a molecular weight of 186.16 g/mol. Its IUPAC name is (3aS,4R,5S,7aR)-4,5-dihydroxy-7-methyl-3a,4,5,7a-tetrahydro-1,3-benzodioxol-2-one.
| Compound Name | (3aS,4R,5S,7aR)-4,5-dihydroxy-7-methyl-3a,4,5,7a-tetrahydro-1,3-benzodioxol-2-one |
|---|---|
| PubChem CID | 91118729 |
| Molecular Formula | C8H10O5 |
| Molecular Weight | 186.16 g/mol |
| Exact Mass | 186.05 |
| IUPAC Name | (3aS,4R,5S,7aR)-4,5-dihydroxy-7-methyl-3a,4,5,7a-tetrahydro-1,3-benzodioxol-2-one |
| SMILES | CC1=C[C@H](O)[C@@H](O)[C@@H]2OC(=O)O[C@H]12 |
| InChI | InChI=1S/C8H10O5/c1-3-2-4(9)5(10)7-6(3)12-8(11)13-7/h2,4-7,9-10H,1H3/t4-,5+,6+,7-/m0/s1 |
| InChIKey | RYEUJNKDXDLZBY-WNJXEPBRSA-N |
| XLogP | -0.43 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.16 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|