C9H11FO — CID 91118805
5-fluoro-7-methylidene-4,5,6,7a-tetrahydro-3aH-1-benzofuran (PubChem CID 91118805) has the molecular formula C9H11FO and a molecular weight of 154.18 g/mol. Its IUPAC name is 5-fluoro-7-methylidene-4,5,6,7a-tetrahydro-3aH-1-benzofuran.
| Compound Name | 5-fluoro-7-methylidene-4,5,6,7a-tetrahydro-3aH-1-benzofuran |
|---|---|
| PubChem CID | 91118805 |
| Molecular Formula | C9H11FO |
| Molecular Weight | 154.18 g/mol |
| Exact Mass | 154.08 |
| IUPAC Name | 5-fluoro-7-methylidene-4,5,6,7a-tetrahydro-3aH-1-benzofuran |
| SMILES | C=C1CC(F)CC2C=COC12 |
| InChI | InChI=1S/C9H11FO/c1-6-4-8(10)5-7-2-3-11-9(6)7/h2-3,7-9H,1,4-5H2 |
| InChIKey | DWIHBDSERBGZDS-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.18 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|