C22H25BrN6O4S2 — CID 91118953
5-(4-bromophenyl)-N-(cyclopentylsulfamoyl)-6-[2-(5-methylsulfanylpyrimidin-2-yl)oxyethoxy]pyrimidin-4-amine (PubChem CID 91118953) has the molecular formula C22H25BrN6O4S2 and a molecular weight of 581.52 g/mol. Its IUPAC name is 5-(4-bromophenyl)-N-(cyclopentylsulfamoyl)-6-[2-(5-methylsulfanylpyrimidin-2-yl)oxyethoxy]pyrimidin-4-amine.
| Compound Name | 5-(4-bromophenyl)-N-(cyclopentylsulfamoyl)-6-[2-(5-methylsulfanylpyrimidin-2-yl)oxyethoxy]pyrimidin-4-amine |
|---|---|
| PubChem CID | 91118953 |
| Molecular Formula | C22H25BrN6O4S2 |
| Molecular Weight | 581.52 g/mol |
| Exact Mass | 580.06 |
| IUPAC Name | 5-(4-bromophenyl)-N-(cyclopentylsulfamoyl)-6-[2-(5-methylsulfanylpyrimidin-2-yl)oxyethoxy]pyrimidin-4-amine |
| SMILES | CSc1cnc(OCCOc2ncnc(NS(=O)(=O)NC3CCCC3)c2-c2ccc(Br)cc2)nc1 |
| InChI | InChI=1S/C22H25BrN6O4S2/c1-34-18-12-24-22(25-13-18)33-11-10-32-21-19(15-6-8-16(23)9-7-15)20(26-14-27-21)29-35(30,31)28-17-4-2-3-5-17/h6-9,12-14,17,28H,2-5,10-11H2,1H3,(H,26,27,29) |
| InChIKey | IEWNTHNOQNSSEF-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 128.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.52 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|