C12H18N2O5S — CID 91119271
(2R)-2-(1-acetylpiperidin-3-yl)-1,3-thiazolidine-3,4-dicarboxylic acid (PubChem CID 91119271) has the molecular formula C12H18N2O5S and a molecular weight of 302.35 g/mol. Its IUPAC name is (2R)-2-(1-acetylpiperidin-3-yl)-1,3-thiazolidine-3,4-dicarboxylic acid.
| Compound Name | (2R)-2-(1-acetylpiperidin-3-yl)-1,3-thiazolidine-3,4-dicarboxylic acid |
|---|---|
| PubChem CID | 91119271 |
| Molecular Formula | C12H18N2O5S |
| Molecular Weight | 302.35 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | (2R)-2-(1-acetylpiperidin-3-yl)-1,3-thiazolidine-3,4-dicarboxylic acid |
| SMILES | CC(=O)N1CCCC([C@H]2SCC(C(=O)O)N2C(=O)O)C1 |
| InChI | InChI=1S/C12H18N2O5S/c1-7(15)13-4-2-3-8(5-13)10-14(12(18)19)9(6-20-10)11(16)17/h8-10H,2-6H2,1H3,(H,16,17)(H,18,19)/t8?,9?,10-/m1/s1 |
| InChIKey | LTXLZHORGCVEBJ-UDNWOFFPSA-N |
| XLogP | 0.75 |
| TPSA | 98.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.35 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |