About (2S)-4-methyl-2-(methylamino)pentanoic acid;(2S)-4-methyl-2-(methylamino)-N-prop-2-enylpentanamide
(2S)-4-methyl-2-(methylamino)pentanoic acid;(2S)-4-methyl-2-(methylamino)-N-prop-2-enylpentanamide (PubChem CID 91119363) has the molecular formula C17H35N3O3
and a molecular weight of 329.49 g/mol. Its IUPAC name is (2S)-4-methyl-2-(methylamino)pentanoic acid;(2S)-4-methyl-2-(methylamino)-N-prop-2-enylpentanamide.
Molecular Properties
| Compound Name | (2S)-4-methyl-2-(methylamino)pentanoic acid;(2S)-4-methyl-2-(methylamino)-N-prop-2-enylpentanamide |
| PubChem CID | 91119363 |
| Molecular Formula | C17H35N3O3 |
| Molecular Weight | 329.49 g/mol |
| Exact Mass | 329.27 |
| IUPAC Name | (2S)-4-methyl-2-(methylamino)pentanoic acid;(2S)-4-methyl-2-(methylamino)-N-prop-2-enylpentanamide |
| SMILES | C=CCNC(=O)[C@H](CC(C)C)NC.CN[C@@H](CC(C)C)C(=O)O |
| InChI | InChI=1S/C10H20N2O.C7H15NO2/c1-5-6-12-10(13)9(11-4)7-8(2)3;1-5(2)4-6(8-3)7(9)10/h5,8-9,11H,1,6-7H2,2-4H3,(H,12,13);5-6,8H,4H2,1-3H3,(H,9,10)/t9-;6-/m00/s1 |
| InChIKey | BQLLNUULTDAQEM-NRDCADONSA-N |
| XLogP | 1.63 |
| TPSA | 90.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 329.49 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2S)-4-methyl-2-(methylamino)pentanoic acid;(2S)-4-methyl-2-(methylamino)-N-prop-2-enylpentanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-4-methyl-2-(methylamino)pentanoic acid;(2S)-4-methyl-2-(methylamino)-N-prop-2-enylpentanamide?
The IUPAC name of (2S)-4-methyl-2-(methylamino)pentanoic acid;(2S)-4-methyl-2-(methylamino)-N-prop-2-enylpentanamide (CID 91119363) is (2S)-4-methyl-2-(methylamino)pentanoic acid;(2S)-4-methyl-2-(methylamino)-N-prop-2-enylpentanamide.
What is the SMILES notation for (2S)-4-methyl-2-(methylamino)pentanoic acid;(2S)-4-methyl-2-(methylamino)-N-prop-2-enylpentanamide?
The canonical SMILES for (2S)-4-methyl-2-(methylamino)pentanoic acid;(2S)-4-methyl-2-(methylamino)-N-prop-2-enylpentanamide is C=CCNC(=O)[C@H](CC(C)C)NC.CN[C@@H](CC(C)C)C(=O)O.
What is the InChIKey of (2S)-4-methyl-2-(methylamino)pentanoic acid;(2S)-4-methyl-2-(methylamino)-N-prop-2-enylpentanamide?
The InChIKey is BQLLNUULTDAQEM-NRDCADONSA-N. The full InChI is InChI=1S/C10H20N2O.C7H15NO2/c1-5-6-12-10(13)9(11-4)7-8(2)3;1-5(2)4-6(8-3)7(9)10/h5,8-9,11H,1,6-7H2,2-4H3,(H,12,13);5-6,8H,4H2,1-3H3,(H,9,10)/t9-;6-/m00/s1.
What are the key properties of (2S)-4-methyl-2-(methylamino)pentanoic acid;(2S)-4-methyl-2-(methylamino)-N-prop-2-enylpentanamide?
(2S)-4-methyl-2-(methylamino)pentanoic acid;(2S)-4-methyl-2-(methylamino)-N-prop-2-enylpentanamide has a molecular weight of 329.49 g/mol, XLogP of 1.63, 10 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-4-methyl-2-(methylamino)pentanoic acid;(2S)-4-methyl-2-(methylamino)-N-prop-2-enylpentanamide is sourced from PubChem (CID 91119363), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).