About 4-(8,8-dimethylazonan-2-yl)-1-methylcyclononan-1-ol
4-(8,8-dimethylazonan-2-yl)-1-methylcyclononan-1-ol (PubChem CID 91119558) has the molecular formula C20H39NO
and a molecular weight of 309.54 g/mol. Its IUPAC name is 4-(8,8-dimethylazonan-2-yl)-1-methylcyclononan-1-ol.
Molecular Properties
| Compound Name | 4-(8,8-dimethylazonan-2-yl)-1-methylcyclononan-1-ol |
| PubChem CID | 91119558 |
| Molecular Formula | C20H39NO |
| Molecular Weight | 309.54 g/mol |
| Exact Mass | 309.30 |
| IUPAC Name | 4-(8,8-dimethylazonan-2-yl)-1-methylcyclononan-1-ol |
| SMILES | CC1(C)CCCCCC(C2CCCCCC(C)(O)CC2)NC1 |
| InChI | InChI=1S/C20H39NO/c1-19(2)13-8-5-7-11-18(21-16-19)17-10-6-4-9-14-20(3,22)15-12-17/h17-18,21-22H,4-16H2,1-3H3 |
| InChIKey | OMHZSMSOIDOXMP-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 309.54 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(8,8-dimethylazonan-2-yl)-1-methylcyclononan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(8,8-dimethylazonan-2-yl)-1-methylcyclononan-1-ol?
The IUPAC name of 4-(8,8-dimethylazonan-2-yl)-1-methylcyclononan-1-ol (CID 91119558) is 4-(8,8-dimethylazonan-2-yl)-1-methylcyclononan-1-ol.
What is the SMILES notation for 4-(8,8-dimethylazonan-2-yl)-1-methylcyclononan-1-ol?
The canonical SMILES for 4-(8,8-dimethylazonan-2-yl)-1-methylcyclononan-1-ol is CC1(C)CCCCCC(C2CCCCCC(C)(O)CC2)NC1.
What is the InChIKey of 4-(8,8-dimethylazonan-2-yl)-1-methylcyclononan-1-ol?
The InChIKey is OMHZSMSOIDOXMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H39NO/c1-19(2)13-8-5-7-11-18(21-16-19)17-10-6-4-9-14-20(3,22)15-12-17/h17-18,21-22H,4-16H2,1-3H3.
What are the key properties of 4-(8,8-dimethylazonan-2-yl)-1-methylcyclononan-1-ol?
4-(8,8-dimethylazonan-2-yl)-1-methylcyclononan-1-ol has a molecular weight of 309.54 g/mol, XLogP of 5.05, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(8,8-dimethylazonan-2-yl)-1-methylcyclononan-1-ol is sourced from PubChem (CID 91119558), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).