C9H13N — CID 91119686
5-methylidene-1,3a,4,6,7,7a-hexahydroindole (PubChem CID 91119686) has the molecular formula C9H13N and a molecular weight of 135.21 g/mol. Its IUPAC name is 5-methylidene-1,3a,4,6,7,7a-hexahydroindole.
| Compound Name | 5-methylidene-1,3a,4,6,7,7a-hexahydroindole |
|---|---|
| PubChem CID | 91119686 |
| Molecular Formula | C9H13N |
| Molecular Weight | 135.21 g/mol |
| Exact Mass | 135.10 |
| IUPAC Name | 5-methylidene-1,3a,4,6,7,7a-hexahydroindole |
| SMILES | C=C1CCC2NC=CC2C1 |
| InChI | InChI=1S/C9H13N/c1-7-2-3-9-8(6-7)4-5-10-9/h4-5,8-10H,1-3,6H2 |
| InChIKey | GCJNQJJDESXUMZ-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 135.21 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|