C28H50N6 — CID 91119830
3-N-[4-(azepan-1-yl)-5,6,7,8-tetrahydroquinazolin-2-yl]-1-nonylpiperidine-2,3-diamine (PubChem CID 91119830) has the molecular formula C28H50N6 and a molecular weight of 470.75 g/mol. Its IUPAC name is 3-N-[4-(azepan-1-yl)-5,6,7,8-tetrahydroquinazolin-2-yl]-1-nonylpiperidine-2,3-diamine.
| Compound Name | 3-N-[4-(azepan-1-yl)-5,6,7,8-tetrahydroquinazolin-2-yl]-1-nonylpiperidine-2,3-diamine |
|---|---|
| PubChem CID | 91119830 |
| Molecular Formula | C28H50N6 |
| Molecular Weight | 470.75 g/mol |
| Exact Mass | 470.41 |
| IUPAC Name | 3-N-[4-(azepan-1-yl)-5,6,7,8-tetrahydroquinazolin-2-yl]-1-nonylpiperidine-2,3-diamine |
| SMILES | CCCCCCCCCN1CCCC(Nc2nc3c(c(N4CCCCCC4)n2)CCCC3)C1N |
| InChI | InChI=1S/C28H50N6/c1-2-3-4-5-6-7-12-19-33-22-15-18-25(26(33)29)31-28-30-24-17-11-10-16-23(24)27(32-28)34-20-13-8-9-14-21-34/h25-26H,2-22,29H2,1H3,(H,30,31,32) |
| InChIKey | WHMBYFKCZPVCNA-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 70.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.75 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|