About 2-[bis[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]amino]acetic acid
2-[bis[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]amino]acetic acid (PubChem CID 91119931) has the molecular formula C14H21N5O2
and a molecular weight of 291.36 g/mol. Its IUPAC name is 2-[bis[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]amino]acetic acid.
Molecular Properties
| Compound Name | 2-[bis[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]amino]acetic acid |
| PubChem CID | 91119931 |
| Molecular Formula | C14H21N5O2 |
| Molecular Weight | 291.36 g/mol |
| Exact Mass | 291.17 |
| IUPAC Name | 2-[bis[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]amino]acetic acid |
| SMILES | Cc1n[nH]c(C)c1CN(CC(=O)O)Cc1c(C)n[nH]c1C |
| InChI | InChI=1S/C14H21N5O2/c1-8-12(9(2)16-15-8)5-19(7-14(20)21)6-13-10(3)17-18-11(13)4/h5-7H2,1-4H3,(H,15,16)(H,17,18)(H,20,21) |
| InChIKey | NWIRRYAZLPOBCM-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 97.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.36 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-[bis[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]amino]acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[bis[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]amino]acetic acid?
The IUPAC name of 2-[bis[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]amino]acetic acid (CID 91119931) is 2-[bis[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]amino]acetic acid.
What is the SMILES notation for 2-[bis[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]amino]acetic acid?
The canonical SMILES for 2-[bis[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]amino]acetic acid is Cc1n[nH]c(C)c1CN(CC(=O)O)Cc1c(C)n[nH]c1C.
What is the InChIKey of 2-[bis[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]amino]acetic acid?
The InChIKey is NWIRRYAZLPOBCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21N5O2/c1-8-12(9(2)16-15-8)5-19(7-14(20)21)6-13-10(3)17-18-11(13)4/h5-7H2,1-4H3,(H,15,16)(H,17,18)(H,20,21).
What are the key properties of 2-[bis[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]amino]acetic acid?
2-[bis[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]amino]acetic acid has a molecular weight of 291.36 g/mol, XLogP of 1.45, 6 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[bis[(3,5-dimethyl-1H-pyrazol-4-yl)methyl]amino]acetic acid is sourced from PubChem (CID 91119931), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).