About [1-(2,5-dihydroxypyrrol-1-yl)oxycarbonyloxy-2-methylpropyl] 2,2-dimethylpropanoate
[1-(2,5-dihydroxypyrrol-1-yl)oxycarbonyloxy-2-methylpropyl] 2,2-dimethylpropanoate (PubChem CID 91119959) has the molecular formula C14H21NO7
and a molecular weight of 315.32 g/mol. Its IUPAC name is [1-(2,5-dihydroxypyrrol-1-yl)oxycarbonyloxy-2-methylpropyl] 2,2-dimethylpropanoate.
Molecular Properties
| Compound Name | [1-(2,5-dihydroxypyrrol-1-yl)oxycarbonyloxy-2-methylpropyl] 2,2-dimethylpropanoate |
| PubChem CID | 91119959 |
| Molecular Formula | C14H21NO7 |
| Molecular Weight | 315.32 g/mol |
| Exact Mass | 315.13 |
| IUPAC Name | [1-(2,5-dihydroxypyrrol-1-yl)oxycarbonyloxy-2-methylpropyl] 2,2-dimethylpropanoate |
| SMILES | CC(C)C(OC(=O)On1c(O)ccc1O)OC(=O)C(C)(C)C |
| InChI | InChI=1S/C14H21NO7/c1-8(2)11(20-12(18)14(3,4)5)21-13(19)22-15-9(16)6-7-10(15)17/h6-8,11,16-17H,1-5H3 |
| InChIKey | YDQVQQBAZUJGRG-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.32 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze [1-(2,5-dihydroxypyrrol-1-yl)oxycarbonyloxy-2-methylpropyl] 2,2-dimethylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(2,5-dihydroxypyrrol-1-yl)oxycarbonyloxy-2-methylpropyl] 2,2-dimethylpropanoate?
The IUPAC name of [1-(2,5-dihydroxypyrrol-1-yl)oxycarbonyloxy-2-methylpropyl] 2,2-dimethylpropanoate (CID 91119959) is [1-(2,5-dihydroxypyrrol-1-yl)oxycarbonyloxy-2-methylpropyl] 2,2-dimethylpropanoate.
What is the SMILES notation for [1-(2,5-dihydroxypyrrol-1-yl)oxycarbonyloxy-2-methylpropyl] 2,2-dimethylpropanoate?
The canonical SMILES for [1-(2,5-dihydroxypyrrol-1-yl)oxycarbonyloxy-2-methylpropyl] 2,2-dimethylpropanoate is CC(C)C(OC(=O)On1c(O)ccc1O)OC(=O)C(C)(C)C.
What is the InChIKey of [1-(2,5-dihydroxypyrrol-1-yl)oxycarbonyloxy-2-methylpropyl] 2,2-dimethylpropanoate?
The InChIKey is YDQVQQBAZUJGRG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21NO7/c1-8(2)11(20-12(18)14(3,4)5)21-13(19)22-15-9(16)6-7-10(15)17/h6-8,11,16-17H,1-5H3.
What are the key properties of [1-(2,5-dihydroxypyrrol-1-yl)oxycarbonyloxy-2-methylpropyl] 2,2-dimethylpropanoate?
[1-(2,5-dihydroxypyrrol-1-yl)oxycarbonyloxy-2-methylpropyl] 2,2-dimethylpropanoate has a molecular weight of 315.32 g/mol, XLogP of 2.04, 4 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(2,5-dihydroxypyrrol-1-yl)oxycarbonyloxy-2-methylpropyl] 2,2-dimethylpropanoate is sourced from PubChem (CID 91119959), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).