About N-ethyl-N',N'-dipropylbutane-1,4-disulfonamide
N-ethyl-N',N'-dipropylbutane-1,4-disulfonamide (PubChem CID 91120060) has the molecular formula C12H28N2O4S2
and a molecular weight of 328.50 g/mol. Its IUPAC name is N-ethyl-N',N'-dipropylbutane-1,4-disulfonamide.
Molecular Properties
| Compound Name | N-ethyl-N',N'-dipropylbutane-1,4-disulfonamide |
| PubChem CID | 91120060 |
| Molecular Formula | C12H28N2O4S2 |
| Molecular Weight | 328.50 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | N-ethyl-N',N'-dipropylbutane-1,4-disulfonamide |
| SMILES | CCCN(CCC)S(=O)(=O)CCCCS(=O)(=O)NCC |
| InChI | InChI=1S/C12H28N2O4S2/c1-4-9-14(10-5-2)20(17,18)12-8-7-11-19(15,16)13-6-3/h13H,4-12H2,1-3H3 |
| InChIKey | ZFAFBUYBKUHRBK-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 328.50 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-ethyl-N',N'-dipropylbutane-1,4-disulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-N',N'-dipropylbutane-1,4-disulfonamide?
The IUPAC name of N-ethyl-N',N'-dipropylbutane-1,4-disulfonamide (CID 91120060) is N-ethyl-N',N'-dipropylbutane-1,4-disulfonamide.
What is the SMILES notation for N-ethyl-N',N'-dipropylbutane-1,4-disulfonamide?
The canonical SMILES for N-ethyl-N',N'-dipropylbutane-1,4-disulfonamide is CCCN(CCC)S(=O)(=O)CCCCS(=O)(=O)NCC.
What is the InChIKey of N-ethyl-N',N'-dipropylbutane-1,4-disulfonamide?
The InChIKey is ZFAFBUYBKUHRBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H28N2O4S2/c1-4-9-14(10-5-2)20(17,18)12-8-7-11-19(15,16)13-6-3/h13H,4-12H2,1-3H3.
What are the key properties of N-ethyl-N',N'-dipropylbutane-1,4-disulfonamide?
N-ethyl-N',N'-dipropylbutane-1,4-disulfonamide has a molecular weight of 328.50 g/mol, XLogP of 1.16, 12 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-N',N'-dipropylbutane-1,4-disulfonamide is sourced from PubChem (CID 91120060), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).