C21H17FN6O2 — CID 91120125
3-[(4-fluorophenyl)methyl]-7-methyl-5-(2H-tetrazol-5-ylmethyl)pyrrolo[3,4-g]quinoline-8,9-diol (PubChem CID 91120125) has the molecular formula C21H17FN6O2 and a molecular weight of 404.41 g/mol. Its IUPAC name is 3-[(4-fluorophenyl)methyl]-7-methyl-5-(2H-tetrazol-5-ylmethyl)pyrrolo[3,4-g]quinoline-8,9-diol.
| Compound Name | 3-[(4-fluorophenyl)methyl]-7-methyl-5-(2H-tetrazol-5-ylmethyl)pyrrolo[3,4-g]quinoline-8,9-diol |
|---|---|
| PubChem CID | 91120125 |
| Molecular Formula | C21H17FN6O2 |
| Molecular Weight | 404.41 g/mol |
| Exact Mass | 404.14 |
| IUPAC Name | 3-[(4-fluorophenyl)methyl]-7-methyl-5-(2H-tetrazol-5-ylmethyl)pyrrolo[3,4-g]quinoline-8,9-diol |
| SMILES | Cn1cc2c(Cc3nn[nH]n3)c3cc(Cc4ccc(F)cc4)cnc3c(O)c2c1O |
| InChI | InChI=1S/C21H17FN6O2/c1-28-10-16-14(8-17-24-26-27-25-17)15-7-12(6-11-2-4-13(22)5-3-11)9-23-19(15)20(29)18(16)21(28)30/h2-5,7,9-10,29-30H,6,8H2,1H3,(H,24,25,26,27) |
| InChIKey | JGGGCBINSMHBHI-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 112.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.41 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'} |
|---|