C29H32FN5O4 — CID 91120194
2-[4-[[2-cyclopentyl-5-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)methyl]-4,6-dioxooxan-2-yl]methoxy]-2-fluorophenyl]-2-methylpropanenitrile (PubChem CID 91120194) has the molecular formula C29H32FN5O4 and a molecular weight of 533.60 g/mol. Its IUPAC name is 2-[4-[[2-cyclopentyl-5-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)methyl]-4,6-dioxooxan-2-yl]methoxy]-2-fluorophenyl]-2-methylpropanenitrile.
| Compound Name | 2-[4-[[2-cyclopentyl-5-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)methyl]-4,6-dioxooxan-2-yl]methoxy]-2-fluorophenyl]-2-methylpropanenitrile |
|---|---|
| PubChem CID | 91120194 |
| Molecular Formula | C29H32FN5O4 |
| Molecular Weight | 533.60 g/mol |
| Exact Mass | 533.24 |
| IUPAC Name | 2-[4-[[2-cyclopentyl-5-[(5,7-dimethyl-[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)methyl]-4,6-dioxooxan-2-yl]methoxy]-2-fluorophenyl]-2-methylpropanenitrile |
| SMILES | Cc1cc(C)n2nc(CC3C(=O)CC(COc4ccc(C(C)(C)C#N)c(F)c4)(C4CCCC4)OC3=O)nc2n1 |
| InChI | InChI=1S/C29H32FN5O4/c1-17-11-18(2)35-27(32-17)33-25(34-35)13-21-24(36)14-29(39-26(21)37,19-7-5-6-8-19)16-38-20-9-10-22(23(30)12-20)28(3,4)15-31/h9-12,19,21H,5-8,13-14,16H2,1-4H3 |
| InChIKey | TYSIGOQIOGZGGY-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 119.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.60 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|