C30H59NO4 — CID 91120306
2,2-dimethylbutanenitrile;dodecyl 2-methylbutanoate;methyl 2,2-dimethylbutanoate (PubChem CID 91120306) has the molecular formula C30H59NO4 and a molecular weight of 497.81 g/mol. Its IUPAC name is 2,2-dimethylbutanenitrile;dodecyl 2-methylbutanoate;methyl 2,2-dimethylbutanoate.
| Compound Name | 2,2-dimethylbutanenitrile;dodecyl 2-methylbutanoate;methyl 2,2-dimethylbutanoate |
|---|---|
| PubChem CID | 91120306 |
| Molecular Formula | C30H59NO4 |
| Molecular Weight | 497.81 g/mol |
| Exact Mass | 497.44 |
| IUPAC Name | 2,2-dimethylbutanenitrile;dodecyl 2-methylbutanoate;methyl 2,2-dimethylbutanoate |
| SMILES | CCC(C)(C)C#N.CCC(C)(C)C(=O)OC.CCCCCCCCCCCCOC(=O)C(C)CC |
| InChI | InChI=1S/C17H34O2.C7H14O2.C6H11N/c1-4-6-7-8-9-10-11-12-13-14-15-19-17(18)16(3)5-2;1-5-7(2,3)6(8)9-4;1-4-6(2,3)5-7/h16H,4-15H2,1-3H3;5H2,1-4H3;4H2,1-3H3 |
| InChIKey | YSFDOSOMKBJSKJ-UHFFFAOYSA-N |
| XLogP | 9.04 |
| TPSA | 76.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.81 |
| LogP ≤ 5 | 9.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|