C12H16N6O5 — CID 91120567
N-[(2R,5R)-5-(6-aminopurin-9-yl)-4-hydroxy-2-(hydroxymethyl)oxolan-3-yl]oxyacetamide (PubChem CID 91120567) has the molecular formula C12H16N6O5 and a molecular weight of 324.30 g/mol. Its IUPAC name is N-[(2R,5R)-5-(6-aminopurin-9-yl)-4-hydroxy-2-(hydroxymethyl)oxolan-3-yl]oxyacetamide.
| Compound Name | N-[(2R,5R)-5-(6-aminopurin-9-yl)-4-hydroxy-2-(hydroxymethyl)oxolan-3-yl]oxyacetamide |
|---|---|
| PubChem CID | 91120567 |
| Molecular Formula | C12H16N6O5 |
| Molecular Weight | 324.30 g/mol |
| Exact Mass | 324.12 |
| IUPAC Name | N-[(2R,5R)-5-(6-aminopurin-9-yl)-4-hydroxy-2-(hydroxymethyl)oxolan-3-yl]oxyacetamide |
| SMILES | CC(=O)NOC1C(O)[C@H](n2cnc3c(N)ncnc32)O[C@@H]1CO |
| InChI | InChI=1S/C12H16N6O5/c1-5(20)17-23-9-6(2-19)22-12(8(9)21)18-4-16-7-10(13)14-3-15-11(7)18/h3-4,6,8-9,12,19,21H,2H2,1H3,(H,17,20)(H2,13,14,15)/t6-,8?,9?,12-/m1/s1 |
| InChIKey | XZNFSRQTOQVMKG-YEFCAQKCSA-N |
| XLogP | -1.90 |
| TPSA | 157.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.30 |
| LogP ≤ 5 | -1.90 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|